C14H23FN2O3S — CID 106044181
2-fluoro-5-(hydroxymethyl)-N-[3-[methyl(propan-2-yl)amino]propyl]benzenesulfonamide (PubChem CID 106044181) has the molecular formula C14H23FN2O3S and a molecular weight of 318.41 g/mol. Its IUPAC name is 2-fluoro-5-(hydroxymethyl)-N-[3-[methyl(propan-2-yl)amino]propyl]benzenesulfonamide.
| Compound Name | 2-fluoro-5-(hydroxymethyl)-N-[3-[methyl(propan-2-yl)amino]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106044181 |
| Molecular Formula | C14H23FN2O3S |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-fluoro-5-(hydroxymethyl)-N-[3-[methyl(propan-2-yl)amino]propyl]benzenesulfonamide |
| SMILES | CC(C)N(C)CCCNS(=O)(=O)c1cc(CO)ccc1F |
| InChI | InChI=1S/C14H23FN2O3S/c1-11(2)17(3)8-4-7-16-21(19,20)14-9-12(10-18)5-6-13(14)15/h5-6,9,11,16,18H,4,7-8,10H2,1-3H3 |
| InChIKey | IQGJFKJLCMDLGM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|