C12H23N3O2S2 — CID 106051072
4-(ethylamino)-N-(4-propan-2-yl-1,3-thiazol-2-yl)butane-1-sulfonamide (PubChem CID 106051072) has the molecular formula C12H23N3O2S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is 4-(ethylamino)-N-(4-propan-2-yl-1,3-thiazol-2-yl)butane-1-sulfonamide.
| Compound Name | 4-(ethylamino)-N-(4-propan-2-yl-1,3-thiazol-2-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106051072 |
| Molecular Formula | C12H23N3O2S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-(ethylamino)-N-(4-propan-2-yl-1,3-thiazol-2-yl)butane-1-sulfonamide |
| SMILES | CCNCCCCS(=O)(=O)Nc1nc(C(C)C)cs1 |
| InChI | InChI=1S/C12H23N3O2S2/c1-4-13-7-5-6-8-19(16,17)15-12-14-11(9-18-12)10(2)3/h9-10,13H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | OEEMIIMLHYUIMR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|