C10H17NO2 — CID 10607523
(6E)-9-methoxy-2,3,4,5,8,9-hexahydro-1H-azecin-10-one (PubChem CID 10607523) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (6E)-9-methoxy-2,3,4,5,8,9-hexahydro-1H-azecin-10-one.
| Compound Name | (6E)-9-methoxy-2,3,4,5,8,9-hexahydro-1H-azecin-10-one |
|---|---|
| PubChem CID | 10607523 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (6E)-9-methoxy-2,3,4,5,8,9-hexahydro-1H-azecin-10-one |
| SMILES | COC1C/C=C/CCCCNC1=O |
| InChI | InChI=1S/C10H17NO2/c1-13-9-7-5-3-2-4-6-8-11-10(9)12/h3,5,9H,2,4,6-8H2,1H3,(H,11,12)/b5-3+ |
| InChIKey | AOKKAYIWWANWPG-HWKANZROSA-N |
| XLogP | 1.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|