C26H43NO2 — CID 123334513
N-ethyl-2-icosa-5,8,11,14,17-pentaenoxybutanamide (PubChem CID 123334513) has the molecular formula C26H43NO2 and a molecular weight of 401.64 g/mol. Its IUPAC name is N-ethyl-2-icosa-5,8,11,14,17-pentaenoxybutanamide.
| Compound Name | N-ethyl-2-icosa-5,8,11,14,17-pentaenoxybutanamide |
|---|---|
| PubChem CID | 123334513 |
| Molecular Formula | C26H43NO2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.33 |
| IUPAC Name | N-ethyl-2-icosa-5,8,11,14,17-pentaenoxybutanamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCOC(CC)C(=O)NCC |
| InChI | InChI=1S/C26H43NO2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-29-25(5-2)26(28)27-6-3/h7-8,10-11,13-14,16-17,19-20,25H,4-6,9,12,15,18,21-24H2,1-3H3,(H,27,28) |
| InChIKey | GIHHUPPAJNZRIU-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|