C14H17BrN2O2S — CID 106077343
4-amino-N-(4-bromonaphthalen-1-yl)butane-1-sulfonamide (PubChem CID 106077343) has the molecular formula C14H17BrN2O2S and a molecular weight of 357.27 g/mol. Its IUPAC name is 4-amino-N-(4-bromonaphthalen-1-yl)butane-1-sulfonamide.
| Compound Name | 4-amino-N-(4-bromonaphthalen-1-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106077343 |
| Molecular Formula | C14H17BrN2O2S |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 4-amino-N-(4-bromonaphthalen-1-yl)butane-1-sulfonamide |
| SMILES | NCCCCS(=O)(=O)Nc1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C14H17BrN2O2S/c15-13-7-8-14(12-6-2-1-5-11(12)13)17-20(18,19)10-4-3-9-16/h1-2,5-8,17H,3-4,9-10,16H2 |
| InChIKey | KWHSTQCVBJZWIC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|