C15H28N2O3S — CID 106079485
2-methyl-N-(2-methylpentan-2-yl)-5-[(propan-2-ylamino)methyl]furan-3-sulfonamide (PubChem CID 106079485) has the molecular formula C15H28N2O3S and a molecular weight of 316.47 g/mol. Its IUPAC name is 2-methyl-N-(2-methylpentan-2-yl)-5-[(propan-2-ylamino)methyl]furan-3-sulfonamide.
| Compound Name | 2-methyl-N-(2-methylpentan-2-yl)-5-[(propan-2-ylamino)methyl]furan-3-sulfonamide |
|---|---|
| PubChem CID | 106079485 |
| Molecular Formula | C15H28N2O3S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-methyl-N-(2-methylpentan-2-yl)-5-[(propan-2-ylamino)methyl]furan-3-sulfonamide |
| SMILES | CCCC(C)(C)NS(=O)(=O)c1cc(CNC(C)C)oc1C |
| InChI | InChI=1S/C15H28N2O3S/c1-7-8-15(5,6)17-21(18,19)14-9-13(20-12(14)4)10-16-11(2)3/h9,11,16-17H,7-8,10H2,1-6H3 |
| InChIKey | DCHUAAFJNBUYHB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |