C8H15NO5 — CID 106103199
2-hydroxyethyl N-[(3-hydroxyoxolan-3-yl)methyl]carbamate (PubChem CID 106103199) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-hydroxyethyl N-[(3-hydroxyoxolan-3-yl)methyl]carbamate.
| Compound Name | 2-hydroxyethyl N-[(3-hydroxyoxolan-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 106103199 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 2-hydroxyethyl N-[(3-hydroxyoxolan-3-yl)methyl]carbamate |
| SMILES | O=C(NCC1(O)CCOC1)OCCO |
| InChI | InChI=1S/C8H15NO5/c10-2-4-14-7(11)9-5-8(12)1-3-13-6-8/h10,12H,1-6H2,(H,9,11) |
| InChIKey | XIVQXLNSJSKEOT-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |