C14H19N3O2 — CID 106104315
4-[1-[2-(1-methylpyrazol-3-yl)ethylamino]ethyl]benzene-1,3-diol (PubChem CID 106104315) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-[1-[2-(1-methylpyrazol-3-yl)ethylamino]ethyl]benzene-1,3-diol.
| Compound Name | 4-[1-[2-(1-methylpyrazol-3-yl)ethylamino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 106104315 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-[1-[2-(1-methylpyrazol-3-yl)ethylamino]ethyl]benzene-1,3-diol |
| SMILES | CC(NCCc1ccn(C)n1)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H19N3O2/c1-10(13-4-3-12(18)9-14(13)19)15-7-5-11-6-8-17(2)16-11/h3-4,6,8-10,15,18-19H,5,7H2,1-2H3 |
| InChIKey | ICDJWTMDNIJBII-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|