C12H14F2N2O4 — CID 106109931
3-[(3,4-difluorophenyl)methylcarbamoylamino]-2-methoxypropanoic acid (PubChem CID 106109931) has the molecular formula C12H14F2N2O4 and a molecular weight of 288.25 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)methylcarbamoylamino]-2-methoxypropanoic acid.
| Compound Name | 3-[(3,4-difluorophenyl)methylcarbamoylamino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 106109931 |
| Molecular Formula | C12H14F2N2O4 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-[(3,4-difluorophenyl)methylcarbamoylamino]-2-methoxypropanoic acid |
| SMILES | COC(CNC(=O)NCc1ccc(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C12H14F2N2O4/c1-20-10(11(17)18)6-16-12(19)15-5-7-2-3-8(13)9(14)4-7/h2-4,10H,5-6H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | JUHPCFDKCKHIOS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |