C11H11N7O — CID 10611150
4-hydrazinyl-1-(4-methylphenyl)-6H-triazolo[4,5-d]pyridazin-7-one (PubChem CID 10611150) has the molecular formula C11H11N7O and a molecular weight of 257.26 g/mol. Its IUPAC name is 4-hydrazinyl-1-(4-methylphenyl)-6H-triazolo[4,5-d]pyridazin-7-one.
| Compound Name | 4-hydrazinyl-1-(4-methylphenyl)-6H-triazolo[4,5-d]pyridazin-7-one |
|---|---|
| PubChem CID | 10611150 |
| Molecular Formula | C11H11N7O |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 4-hydrazinyl-1-(4-methylphenyl)-6H-triazolo[4,5-d]pyridazin-7-one |
| SMILES | Cc1ccc(-n2nnc3c(NN)n[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C11H11N7O/c1-6-2-4-7(5-3-6)18-9-8(14-17-18)10(13-12)15-16-11(9)19/h2-5H,12H2,1H3,(H,13,15)(H,16,19) |
| InChIKey | RGEDNWOMBHVKGK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|