C12H24ClNO3 — CID 106117629
N-[2-(2-chloroethyl)pentyl]-2-(2-methoxyethoxy)acetamide (PubChem CID 106117629) has the molecular formula C12H24ClNO3 and a molecular weight of 265.78 g/mol. Its IUPAC name is N-[2-(2-chloroethyl)pentyl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[2-(2-chloroethyl)pentyl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 106117629 |
| Molecular Formula | C12H24ClNO3 |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-[2-(2-chloroethyl)pentyl]-2-(2-methoxyethoxy)acetamide |
| SMILES | CCCC(CCCl)CNC(=O)COCCOC |
| InChI | InChI=1S/C12H24ClNO3/c1-3-4-11(5-6-13)9-14-12(15)10-17-8-7-16-2/h11H,3-10H2,1-2H3,(H,14,15) |
| InChIKey | IWUZJLHQVLLDCD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|