C16H26O3 — CID 10611824
(E)-6-(1,4-dioxaspiro[4.5]dec-6-en-6-yl)-3,4-dimethylhex-2-en-1-ol (PubChem CID 10611824) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (E)-6-(1,4-dioxaspiro[4.5]dec-6-en-6-yl)-3,4-dimethylhex-2-en-1-ol.
| Compound Name | (E)-6-(1,4-dioxaspiro[4.5]dec-6-en-6-yl)-3,4-dimethylhex-2-en-1-ol |
|---|---|
| PubChem CID | 10611824 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (E)-6-(1,4-dioxaspiro[4.5]dec-6-en-6-yl)-3,4-dimethylhex-2-en-1-ol |
| SMILES | C/C(=C\CO)C(C)CCC1=CCCCC12OCCO2 |
| InChI | InChI=1S/C16H26O3/c1-13(14(2)8-10-17)6-7-15-5-3-4-9-16(15)18-11-12-19-16/h5,8,13,17H,3-4,6-7,9-12H2,1-2H3/b14-8+ |
| InChIKey | RWRDQCAMINDHFN-RIYZIHGNSA-N |
| XLogP | 3.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|