C18H28O3 — CID 139256439
(4S,6S)-6-[(3aR,7aS)-2,2,7-trimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-2-methylhept-2-en-4-ol (PubChem CID 139256439) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (4S,6S)-6-[(3aR,7aS)-2,2,7-trimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-2-methylhept-2-en-4-ol.
| Compound Name | (4S,6S)-6-[(3aR,7aS)-2,2,7-trimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-2-methylhept-2-en-4-ol |
|---|---|
| PubChem CID | 139256439 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (4S,6S)-6-[(3aR,7aS)-2,2,7-trimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-2-methylhept-2-en-4-ol |
| SMILES | CC(C)=C[C@@H](O)C[C@H](C)C1=CC=C(C)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C18H28O3/c1-11(2)9-14(19)10-13(4)15-8-7-12(3)16-17(15)21-18(5,6)20-16/h7-9,13-14,16-17,19H,10H2,1-6H3/t13-,14+,16-,17+/m0/s1 |
| InChIKey | UIOYIJPPAYQDEF-HDEZJCGLSA-N |
| XLogP | 3.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|