C14H17F3N2O — CID 106123128
N-[(3-aminocyclohexyl)methyl]-2,4,6-trifluorobenzamide (PubChem CID 106123128) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is N-[(3-aminocyclohexyl)methyl]-2,4,6-trifluorobenzamide.
| Compound Name | N-[(3-aminocyclohexyl)methyl]-2,4,6-trifluorobenzamide |
|---|---|
| PubChem CID | 106123128 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-[(3-aminocyclohexyl)methyl]-2,4,6-trifluorobenzamide |
| SMILES | NC1CCCC(CNC(=O)c2c(F)cc(F)cc2F)C1 |
| InChI | InChI=1S/C14H17F3N2O/c15-9-5-11(16)13(12(17)6-9)14(20)19-7-8-2-1-3-10(18)4-8/h5-6,8,10H,1-4,7,18H2,(H,19,20) |
| InChIKey | ATCPHXUQFFCSBL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |