C11H22N2O — CID 106131041
5-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)pentan-2-ol (PubChem CID 106131041) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 5-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)pentan-2-ol.
| Compound Name | 5-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)pentan-2-ol |
|---|---|
| PubChem CID | 106131041 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 5-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)pentan-2-ol |
| SMILES | CC(O)CCCNC1=NCCCCC1 |
| InChI | InChI=1S/C11H22N2O/c1-10(14)6-5-9-13-11-7-3-2-4-8-12-11/h10,14H,2-9H2,1H3,(H,12,13) |
| InChIKey | UVCDDGBTZIMDKO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|