C13H21NO2 — CID 106145926
1-(4-hydroxy-2,2-dimethylbutyl)-2,6-dimethylpyridin-4-one (PubChem CID 106145926) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-(4-hydroxy-2,2-dimethylbutyl)-2,6-dimethylpyridin-4-one.
| Compound Name | 1-(4-hydroxy-2,2-dimethylbutyl)-2,6-dimethylpyridin-4-one |
|---|---|
| PubChem CID | 106145926 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 1-(4-hydroxy-2,2-dimethylbutyl)-2,6-dimethylpyridin-4-one |
| SMILES | Cc1cc(=O)cc(C)n1CC(C)(C)CCO |
| InChI | InChI=1S/C13H21NO2/c1-10-7-12(16)8-11(2)14(10)9-13(3,4)5-6-15/h7-8,15H,5-6,9H2,1-4H3 |
| InChIKey | YZOUZBNYSNUADC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |