C16H22O6 — CID 10614888
(3aS,4S,7R,7aR)-4-[(1R)-3-(1,3-dioxolan-2-yl)-1-methoxypropyl]-7-methyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 10614888) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is (3aS,4S,7R,7aR)-4-[(1R)-3-(1,3-dioxolan-2-yl)-1-methoxypropyl]-7-methyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | (3aS,4S,7R,7aR)-4-[(1R)-3-(1,3-dioxolan-2-yl)-1-methoxypropyl]-7-methyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 10614888 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (3aS,4S,7R,7aR)-4-[(1R)-3-(1,3-dioxolan-2-yl)-1-methoxypropyl]-7-methyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | CO[C@H](CCC1OCCO1)[C@H]1C=C[C@@H](C)[C@H]2C(=O)OC(=O)[C@@H]12 |
| InChI | InChI=1S/C16H22O6/c1-9-3-4-10(14-13(9)15(17)22-16(14)18)11(19-2)5-6-12-20-7-8-21-12/h3-4,9-14H,5-8H2,1-2H3/t9-,10-,11-,13-,14+/m1/s1 |
| InChIKey | CFZZLXQYFWBYBS-XMKDAVRRSA-N |
| XLogP | 1.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|