C12H18ClN3O4S — CID 106150775
ethyl (3R)-1-(4-chloro-1-methylpyrazol-5-yl)sulfonylpiperidine-3-carboxylate (PubChem CID 106150775) has the molecular formula C12H18ClN3O4S and a molecular weight of 335.81 g/mol. Its IUPAC name is ethyl (3R)-1-(4-chloro-1-methylpyrazol-5-yl)sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(4-chloro-1-methylpyrazol-5-yl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 106150775 |
| Molecular Formula | C12H18ClN3O4S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | ethyl (3R)-1-(4-chloro-1-methylpyrazol-5-yl)sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(S(=O)(=O)c2c(Cl)cnn2C)C1 |
| InChI | InChI=1S/C12H18ClN3O4S/c1-3-20-12(17)9-5-4-6-16(8-9)21(18,19)11-10(13)7-14-15(11)2/h7,9H,3-6,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | YDKMRHOOTOMUDJ-SECBINFHSA-N |
| XLogP | 1.04 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |