C12H18BrNO2S — CID 106156390
N-(4-bromo-1-methoxybutan-2-yl)-5-ethylthiophene-2-carboxamide (PubChem CID 106156390) has the molecular formula C12H18BrNO2S and a molecular weight of 320.25 g/mol. Its IUPAC name is N-(4-bromo-1-methoxybutan-2-yl)-5-ethylthiophene-2-carboxamide.
| Compound Name | N-(4-bromo-1-methoxybutan-2-yl)-5-ethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 106156390 |
| Molecular Formula | C12H18BrNO2S |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | N-(4-bromo-1-methoxybutan-2-yl)-5-ethylthiophene-2-carboxamide |
| SMILES | CCc1ccc(C(=O)NC(CCBr)COC)s1 |
| InChI | InChI=1S/C12H18BrNO2S/c1-3-10-4-5-11(17-10)12(15)14-9(6-7-13)8-16-2/h4-5,9H,3,6-8H2,1-2H3,(H,14,15) |
| InChIKey | MCBXDBZNCSFXCG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|