C20H32O3 — CID 10615674
(1R,6R,9R,10S,11S,13S,14R,16S)-5,5,9,13-tetramethyl-12-oxapentacyclo[11.2.1.111,14.01,10.04,9]heptadecane-6,16-diol (PubChem CID 10615674) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1R,6R,9R,10S,11S,13S,14R,16S)-5,5,9,13-tetramethyl-12-oxapentacyclo[11.2.1.111,14.01,10.04,9]heptadecane-6,16-diol.
| Compound Name | (1R,6R,9R,10S,11S,13S,14R,16S)-5,5,9,13-tetramethyl-12-oxapentacyclo[11.2.1.111,14.01,10.04,9]heptadecane-6,16-diol |
|---|---|
| PubChem CID | 10615674 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1R,6R,9R,10S,11S,13S,14R,16S)-5,5,9,13-tetramethyl-12-oxapentacyclo[11.2.1.111,14.01,10.04,9]heptadecane-6,16-diol |
| SMILES | CC1(C)C2CC[C@]34C[C@@H]5C[C@H](O[C@]5(C)[C@H]3O)[C@H]4[C@]2(C)CC[C@H]1O |
| InChI | InChI=1S/C20H32O3/c1-17(2)13-5-8-20-10-11-9-12(23-19(11,4)16(20)22)15(20)18(13,3)7-6-14(17)21/h11-16,21-22H,5-10H2,1-4H3/t11-,12-,13?,14+,15-,16+,18+,19-,20+/m0/s1 |
| InChIKey | STJHXIUOGTWAJR-DHUCQGHQSA-N |
| XLogP | 3.13 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |