C19H19N3O2 — CID 10615759
2-[2-(dimethylamino)ethyl]-3,11-dihydropyrrolo[3,4-c]acridine-1,6-dione (PubChem CID 10615759) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-3,11-dihydropyrrolo[3,4-c]acridine-1,6-dione.
| Compound Name | 2-[2-(dimethylamino)ethyl]-3,11-dihydropyrrolo[3,4-c]acridine-1,6-dione |
|---|---|
| PubChem CID | 10615759 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-3,11-dihydropyrrolo[3,4-c]acridine-1,6-dione |
| SMILES | CN(C)CCN1Cc2ccc3c(=O)c4ccccc4[nH]c3c2C1=O |
| InChI | InChI=1S/C19H19N3O2/c1-21(2)9-10-22-11-12-7-8-14-17(16(12)19(22)24)20-15-6-4-3-5-13(15)18(14)23/h3-8H,9-11H2,1-2H3,(H,20,23) |
| InChIKey | VRMOFDHSFXHXTC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|