C8H14Br2N4O3S — CID 106158394
5-bromo-N-(4-bromo-1-methoxybutan-2-yl)-3-methyltriazole-4-sulfonamide (PubChem CID 106158394) has the molecular formula C8H14Br2N4O3S and a molecular weight of 406.10 g/mol. Its IUPAC name is 5-bromo-N-(4-bromo-1-methoxybutan-2-yl)-3-methyltriazole-4-sulfonamide.
| Compound Name | 5-bromo-N-(4-bromo-1-methoxybutan-2-yl)-3-methyltriazole-4-sulfonamide |
|---|---|
| PubChem CID | 106158394 |
| Molecular Formula | C8H14Br2N4O3S |
| Molecular Weight | 406.10 g/mol |
| Exact Mass | 403.92 |
| IUPAC Name | 5-bromo-N-(4-bromo-1-methoxybutan-2-yl)-3-methyltriazole-4-sulfonamide |
| SMILES | COCC(CCBr)NS(=O)(=O)c1c(Br)nnn1C |
| InChI | InChI=1S/C8H14Br2N4O3S/c1-14-8(7(10)11-13-14)18(15,16)12-6(3-4-9)5-17-2/h6,12H,3-5H2,1-2H3 |
| InChIKey | BXBLFOXZZNNLIA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.10 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|