C8H17F2NO — CID 106160199
5-(2,2-difluoroethylamino)-2-methylpentan-1-ol (PubChem CID 106160199) has the molecular formula C8H17F2NO and a molecular weight of 181.23 g/mol. Its IUPAC name is 5-(2,2-difluoroethylamino)-2-methylpentan-1-ol.
| Compound Name | 5-(2,2-difluoroethylamino)-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 106160199 |
| Molecular Formula | C8H17F2NO |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 5-(2,2-difluoroethylamino)-2-methylpentan-1-ol |
| SMILES | CC(CO)CCCNCC(F)F |
| InChI | InChI=1S/C8H17F2NO/c1-7(6-12)3-2-4-11-5-8(9)10/h7-8,11-12H,2-6H2,1H3 |
| InChIKey | CXITUKIEJYNMPZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|