C9H16N4OS — CID 106162990
3-[(6-aminopyridazin-3-yl)amino]-2-methylsulfanylbutan-1-ol (PubChem CID 106162990) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 3-[(6-aminopyridazin-3-yl)amino]-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-[(6-aminopyridazin-3-yl)amino]-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 106162990 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-[(6-aminopyridazin-3-yl)amino]-2-methylsulfanylbutan-1-ol |
| SMILES | CSC(CO)C(C)Nc1ccc(N)nn1 |
| InChI | InChI=1S/C9H16N4OS/c1-6(7(5-14)15-2)11-9-4-3-8(10)12-13-9/h3-4,6-7,14H,5H2,1-2H3,(H2,10,12)(H,11,13) |
| InChIKey | YYNANBVUXIYTPU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |