C12H12Cl2N2O5 — CID 10616760
2,2-dichloro-N-[(4R,5R)-4-(4-nitrophenyl)-1,3-dioxan-5-yl]acetamide (PubChem CID 10616760) has the molecular formula C12H12Cl2N2O5 and a molecular weight of 335.14 g/mol. Its IUPAC name is 2,2-dichloro-N-[(4R,5R)-4-(4-nitrophenyl)-1,3-dioxan-5-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[(4R,5R)-4-(4-nitrophenyl)-1,3-dioxan-5-yl]acetamide |
|---|---|
| PubChem CID | 10616760 |
| Molecular Formula | C12H12Cl2N2O5 |
| Molecular Weight | 335.14 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 2,2-dichloro-N-[(4R,5R)-4-(4-nitrophenyl)-1,3-dioxan-5-yl]acetamide |
| SMILES | O=C(N[C@@H]1COCO[C@@H]1c1ccc([N+](=O)[O-])cc1)C(Cl)Cl |
| InChI | InChI=1S/C12H12Cl2N2O5/c13-11(14)12(17)15-9-5-20-6-21-10(9)7-1-3-8(4-2-7)16(18)19/h1-4,9-11H,5-6H2,(H,15,17)/t9-,10-/m1/s1 |
| InChIKey | BIYRHGRDGUFBFI-NXEZZACHSA-N |
| XLogP | 1.93 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.14 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|