C11H13N2O4+ — CID 6935181
(7R,7aR)-7-(4-nitrophenyl)-1,3,4,5,7,7a-hexahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium (PubChem CID 6935181) has the molecular formula C11H13N2O4+ and a molecular weight of 237.23 g/mol. Its IUPAC name is (7R,7aR)-7-(4-nitrophenyl)-1,3,4,5,7,7a-hexahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium.
| Compound Name | (7R,7aR)-7-(4-nitrophenyl)-1,3,4,5,7,7a-hexahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium |
|---|---|
| PubChem CID | 6935181 |
| Molecular Formula | C11H13N2O4+ |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | (7R,7aR)-7-(4-nitrophenyl)-1,3,4,5,7,7a-hexahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium |
| SMILES | O=[N+]([O-])c1ccc([C@H]2OC[NH+]3COC[C@H]23)cc1 |
| InChI | InChI=1S/C11H12N2O4/c14-13(15)9-3-1-8(2-4-9)11-10-5-16-6-12(10)7-17-11/h1-4,10-11H,5-7H2/p+1/t10-,11-/m1/s1 |
| InChIKey | DBDXAJVSKWAGLH-GHMZBOCLSA-O |
| XLogP | -0.14 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|