C15H19N2O4+ — CID 23246296
(1S,3S,4S,7R)-11-methyl-3-(4-nitrophenyl)-2,6-dioxa-11-azoniatricyclo[5.3.1.04,11]undecane (PubChem CID 23246296) has the molecular formula C15H19N2O4+ and a molecular weight of 291.33 g/mol. Its IUPAC name is (1S,3S,4S,7R)-11-methyl-3-(4-nitrophenyl)-2,6-dioxa-11-azoniatricyclo[5.3.1.04,11]undecane.
| Compound Name | (1S,3S,4S,7R)-11-methyl-3-(4-nitrophenyl)-2,6-dioxa-11-azoniatricyclo[5.3.1.04,11]undecane |
|---|---|
| PubChem CID | 23246296 |
| Molecular Formula | C15H19N2O4+ |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (1S,3S,4S,7R)-11-methyl-3-(4-nitrophenyl)-2,6-dioxa-11-azoniatricyclo[5.3.1.04,11]undecane |
| SMILES | C[N+]12[C@@H]3CCC[C@H]1OC[C@H]2[C@H](c1ccc([N+](=O)[O-])cc1)O3 |
| InChI | InChI=1S/C15H19N2O4/c1-17-12-9-20-13(17)3-2-4-14(17)21-15(12)10-5-7-11(8-6-10)16(18)19/h5-8,12-15H,2-4,9H2,1H3/q+1/t12-,13+,14-,15-,17?/m0/s1 |
| InChIKey | IGHCLFBZFMVYOC-QFBCABTNSA-N |
| XLogP | 2.35 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|