C9H15F2N — CID 106173983
N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroethanamine (PubChem CID 106173983) has the molecular formula C9H15F2N and a molecular weight of 175.22 g/mol. Its IUPAC name is N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroethanamine.
| Compound Name | N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 106173983 |
| Molecular Formula | C9H15F2N |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroethanamine |
| SMILES | FC(F)CNCCC1=CCCC1 |
| InChI | InChI=1S/C9H15F2N/c10-9(11)7-12-6-5-8-3-1-2-4-8/h3,9,12H,1-2,4-7H2 |
| InChIKey | XDTYEWUATONSBA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|