C20H24O5 — CID 10617420
[(E)-4-methoxy-5-[(1S,5R,7S)-6-oxo-7-phenyl-2-oxabicyclo[3.2.0]heptan-7-yl]pent-4-enyl] acetate (PubChem CID 10617420) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is [(E)-4-methoxy-5-[(1S,5R,7S)-6-oxo-7-phenyl-2-oxabicyclo[3.2.0]heptan-7-yl]pent-4-enyl] acetate.
| Compound Name | [(E)-4-methoxy-5-[(1S,5R,7S)-6-oxo-7-phenyl-2-oxabicyclo[3.2.0]heptan-7-yl]pent-4-enyl] acetate |
|---|---|
| PubChem CID | 10617420 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [(E)-4-methoxy-5-[(1S,5R,7S)-6-oxo-7-phenyl-2-oxabicyclo[3.2.0]heptan-7-yl]pent-4-enyl] acetate |
| SMILES | CO/C(=C/[C@@]1(c2ccccc2)C(=O)[C@@H]2CCO[C@@H]21)CCCOC(C)=O |
| InChI | InChI=1S/C20H24O5/c1-14(21)24-11-6-9-16(23-2)13-20(15-7-4-3-5-8-15)18(22)17-10-12-25-19(17)20/h3-5,7-8,13,17,19H,6,9-12H2,1-2H3/b16-13+/t17-,19-,20+/m0/s1 |
| InChIKey | ZDPRACXOVOOJHL-YTLRCJCDSA-N |
| XLogP | 2.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|