C23H24O5 — CID 20975238
[(3S,4S,9bR)-3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] 2-phenylacetate (PubChem CID 20975238) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is [(3S,4S,9bR)-3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] 2-phenylacetate.
| Compound Name | [(3S,4S,9bR)-3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 20975238 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [(3S,4S,9bR)-3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] 2-phenylacetate |
| SMILES | CC1=CC(=O)C2=C(C)C[C@H](OC(=O)Cc3ccccc3)C3C(C)C(=O)O[C@@H]3C12 |
| InChI | InChI=1S/C23H24O5/c1-12-9-16(24)19-13(2)10-17(21-14(3)23(26)28-22(21)20(12)19)27-18(25)11-15-7-5-4-6-8-15/h4-9,14,17,20-22H,10-11H2,1-3H3/t14?,17-,20?,21?,22+/m0/s1 |
| InChIKey | NNLJICJPZZZIFI-SDMHYHOBSA-N |
| XLogP | 3.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |