C12H14N2OS — CID 106184667
4-(2,3-dihydro-1-benzothiophen-3-ylamino)pyrrolidin-2-one (PubChem CID 106184667) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzothiophen-3-ylamino)pyrrolidin-2-one.
| Compound Name | 4-(2,3-dihydro-1-benzothiophen-3-ylamino)pyrrolidin-2-one |
|---|---|
| PubChem CID | 106184667 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-(2,3-dihydro-1-benzothiophen-3-ylamino)pyrrolidin-2-one |
| SMILES | O=C1CC(NC2CSc3ccccc32)CN1 |
| InChI | InChI=1S/C12H14N2OS/c15-12-5-8(6-13-12)14-10-7-16-11-4-2-1-3-9(10)11/h1-4,8,10,14H,5-7H2,(H,13,15) |
| InChIKey | CYXAWKAXLQLHMI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |