C21H23NO6 — CID 10620102
dimethyl 7-benzyl-6-oxo-1-oxa-7-azadispiro[2.1.55.23]dodec-11-ene-11,12-dicarboxylate (PubChem CID 10620102) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is dimethyl 7-benzyl-6-oxo-1-oxa-7-azadispiro[2.1.55.23]dodec-11-ene-11,12-dicarboxylate.
| Compound Name | dimethyl 7-benzyl-6-oxo-1-oxa-7-azadispiro[2.1.55.23]dodec-11-ene-11,12-dicarboxylate |
|---|---|
| PubChem CID | 10620102 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | dimethyl 7-benzyl-6-oxo-1-oxa-7-azadispiro[2.1.55.23]dodec-11-ene-11,12-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(CCCN(Cc3ccccc3)C2=O)CC12CO2 |
| InChI | InChI=1S/C21H23NO6/c1-26-17(23)15-16(18(24)27-2)21(13-28-21)12-20(15)9-6-10-22(19(20)25)11-14-7-4-3-5-8-14/h3-5,7-8H,6,9-13H2,1-2H3 |
| InChIKey | BTOFVWALEGIVDK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 85.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|