C25H32O5 — CID 10621624
(1R,2S,3R,6R,7S,9R,10S,12S,14S)-9-hydroxy-2,6,10,12-tetramethyl-3-phenylmethoxy-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-4,11-dione (PubChem CID 10621624) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is (1R,2S,3R,6R,7S,9R,10S,12S,14S)-9-hydroxy-2,6,10,12-tetramethyl-3-phenylmethoxy-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-4,11-dione.
| Compound Name | (1R,2S,3R,6R,7S,9R,10S,12S,14S)-9-hydroxy-2,6,10,12-tetramethyl-3-phenylmethoxy-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-4,11-dione |
|---|---|
| PubChem CID | 10621624 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (1R,2S,3R,6R,7S,9R,10S,12S,14S)-9-hydroxy-2,6,10,12-tetramethyl-3-phenylmethoxy-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-4,11-dione |
| SMILES | C[C@@H]1CC(=O)[C@H](OCc2ccccc2)[C@@]2(C)[C@H]1C[C@@H](O)[C@@]1(C)C(=O)[C@@]3(C)O[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C25H32O5/c1-14-10-17(26)21(29-13-15-8-6-5-7-9-15)23(2)16(14)11-19(27)24(3)18(23)12-20-25(4,30-20)22(24)28/h5-9,14,16,18-21,27H,10-13H2,1-4H3/t14-,16+,18-,19-,20+,21+,23+,24+,25+/m1/s1 |
| InChIKey | PAAIHAQSWHQIGA-OEXCJNJJSA-N |
| XLogP | 3.32 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|