C12H14ClF3N4 — CID 106216949
5-(2-chloroethyl)-1,3-dimethyl-6-[1-(trifluoromethyl)cyclopropyl]imidazo[4,5-d]pyrazole (PubChem CID 106216949) has the molecular formula C12H14ClF3N4 and a molecular weight of 306.72 g/mol. Its IUPAC name is 5-(2-chloroethyl)-1,3-dimethyl-6-[1-(trifluoromethyl)cyclopropyl]imidazo[4,5-d]pyrazole.
| Compound Name | 5-(2-chloroethyl)-1,3-dimethyl-6-[1-(trifluoromethyl)cyclopropyl]imidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 106216949 |
| Molecular Formula | C12H14ClF3N4 |
| Molecular Weight | 306.72 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 5-(2-chloroethyl)-1,3-dimethyl-6-[1-(trifluoromethyl)cyclopropyl]imidazo[4,5-d]pyrazole |
| SMILES | Cc1nn(C)c2c1nc(CCCl)n2C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H14ClF3N4/c1-7-9-10(19(2)18-7)20(8(17-9)3-6-13)11(4-5-11)12(14,15)16/h3-6H2,1-2H3 |
| InChIKey | OWIIJEMMMLNFMF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.72 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|