C14H21ClN4O — CID 79297749
5-(2-chloroethyl)-1,3-dimethyl-6-(oxan-2-ylmethyl)imidazo[4,5-d]pyrazole (PubChem CID 79297749) has the molecular formula C14H21ClN4O and a molecular weight of 296.80 g/mol. Its IUPAC name is 5-(2-chloroethyl)-1,3-dimethyl-6-(oxan-2-ylmethyl)imidazo[4,5-d]pyrazole.
| Compound Name | 5-(2-chloroethyl)-1,3-dimethyl-6-(oxan-2-ylmethyl)imidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 79297749 |
| Molecular Formula | C14H21ClN4O |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 5-(2-chloroethyl)-1,3-dimethyl-6-(oxan-2-ylmethyl)imidazo[4,5-d]pyrazole |
| SMILES | Cc1nn(C)c2c1nc(CCCl)n2CC1CCCCO1 |
| InChI | InChI=1S/C14H21ClN4O/c1-10-13-14(18(2)17-10)19(12(16-13)6-7-15)9-11-5-3-4-8-20-11/h11H,3-9H2,1-2H3 |
| InChIKey | DFOCHEYXVFVXAH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|