C14H21ClN4S — CID 80612682
5-(1-chloroethyl)-1,3-dimethyl-6-(thian-2-ylmethyl)imidazo[4,5-d]pyrazole (PubChem CID 80612682) has the molecular formula C14H21ClN4S and a molecular weight of 312.87 g/mol. Its IUPAC name is 5-(1-chloroethyl)-1,3-dimethyl-6-(thian-2-ylmethyl)imidazo[4,5-d]pyrazole.
| Compound Name | 5-(1-chloroethyl)-1,3-dimethyl-6-(thian-2-ylmethyl)imidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 80612682 |
| Molecular Formula | C14H21ClN4S |
| Molecular Weight | 312.87 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 5-(1-chloroethyl)-1,3-dimethyl-6-(thian-2-ylmethyl)imidazo[4,5-d]pyrazole |
| SMILES | Cc1nn(C)c2c1nc(C(C)Cl)n2CC1CCCCS1 |
| InChI | InChI=1S/C14H21ClN4S/c1-9(15)13-16-12-10(2)17-18(3)14(12)19(13)8-11-6-4-5-7-20-11/h9,11H,4-8H2,1-3H3 |
| InChIKey | QLYBHYBNEYMUDE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.87 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|