C10H13N3O4S — CID 106224085
5-methyl-4-(pent-1-yn-3-ylsulfamoyl)-1H-pyrazole-3-carboxylic acid (PubChem CID 106224085) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is 5-methyl-4-(pent-1-yn-3-ylsulfamoyl)-1H-pyrazole-3-carboxylic acid.
| Compound Name | 5-methyl-4-(pent-1-yn-3-ylsulfamoyl)-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 106224085 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 5-methyl-4-(pent-1-yn-3-ylsulfamoyl)-1H-pyrazole-3-carboxylic acid |
| SMILES | C#CC(CC)NS(=O)(=O)c1c(C(=O)O)n[nH]c1C |
| InChI | InChI=1S/C10H13N3O4S/c1-4-7(5-2)13-18(16,17)9-6(3)11-12-8(9)10(14)15/h1,7,13H,5H2,2-3H3,(H,11,12)(H,14,15) |
| InChIKey | YXHQNAXXNIVHKH-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|