C14H18Cl2N4O — CID 106229546
1-[1-[2-(2,4-dichlorophenoxy)ethyl]triazol-4-yl]butan-1-amine (PubChem CID 106229546) has the molecular formula C14H18Cl2N4O and a molecular weight of 329.23 g/mol. Its IUPAC name is 1-[1-[2-(2,4-dichlorophenoxy)ethyl]triazol-4-yl]butan-1-amine.
| Compound Name | 1-[1-[2-(2,4-dichlorophenoxy)ethyl]triazol-4-yl]butan-1-amine |
|---|---|
| PubChem CID | 106229546 |
| Molecular Formula | C14H18Cl2N4O |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 1-[1-[2-(2,4-dichlorophenoxy)ethyl]triazol-4-yl]butan-1-amine |
| SMILES | CCCC(N)c1cn(CCOc2ccc(Cl)cc2Cl)nn1 |
| InChI | InChI=1S/C14H18Cl2N4O/c1-2-3-12(17)13-9-20(19-18-13)6-7-21-14-5-4-10(15)8-11(14)16/h4-5,8-9,12H,2-3,6-7,17H2,1H3 |
| InChIKey | JTRMFDREVLOYQX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |