C14H16N2S — CID 106230034
N-(1,3-benzothiazol-2-ylmethyl)hex-1-yn-3-amine (PubChem CID 106230034) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)hex-1-yn-3-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)hex-1-yn-3-amine |
|---|---|
| PubChem CID | 106230034 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)hex-1-yn-3-amine |
| SMILES | C#CC(CCC)NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H16N2S/c1-3-7-11(4-2)15-10-14-16-12-8-5-6-9-13(12)17-14/h2,5-6,8-9,11,15H,3,7,10H2,1H3 |
| InChIKey | MAXIOESXBFHSKV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|