C28H19N5O3 — CID 10624306
21-(4-nitrophenyl)-19-phenyl-16-oxa-15,18,20,21-tetrazapentacyclo[12.7.0.01,18.02,7.08,13]henicosa-2,4,6,8,10,12,14,19-octaene (PubChem CID 10624306) has the molecular formula C28H19N5O3 and a molecular weight of 473.49 g/mol. Its IUPAC name is 21-(4-nitrophenyl)-19-phenyl-16-oxa-15,18,20,21-tetrazapentacyclo[12.7.0.01,18.02,7.08,13]henicosa-2,4,6,8,10,12,14,19-octaene.
| Compound Name | 21-(4-nitrophenyl)-19-phenyl-16-oxa-15,18,20,21-tetrazapentacyclo[12.7.0.01,18.02,7.08,13]henicosa-2,4,6,8,10,12,14,19-octaene |
|---|---|
| PubChem CID | 10624306 |
| Molecular Formula | C28H19N5O3 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 21-(4-nitrophenyl)-19-phenyl-16-oxa-15,18,20,21-tetrazapentacyclo[12.7.0.01,18.02,7.08,13]henicosa-2,4,6,8,10,12,14,19-octaene |
| SMILES | O=[N+]([O-])c1ccc(N2N=C(c3ccccc3)N3CON=C4c5ccccc5-c5ccccc5C432)cc1 |
| InChI | InChI=1S/C28H19N5O3/c34-33(35)21-16-14-20(15-17-21)32-28-25-13-7-6-11-23(25)22-10-4-5-12-24(22)26(28)30-36-18-31(28)27(29-32)19-8-2-1-3-9-19/h1-17H,18H2 |
| InChIKey | HNBZXCOTXIPXKS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 83.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|