C34H26N6O2 — CID 14868163
(8aR)-1-(4-nitrophenyl)-3,6,8,8a-tetraphenyl-5H-[1,2,4]triazolo[4,3-d][1,2,4]triazine (PubChem CID 14868163) has the molecular formula C34H26N6O2 and a molecular weight of 550.62 g/mol. Its IUPAC name is (8aR)-1-(4-nitrophenyl)-3,6,8,8a-tetraphenyl-5H-[1,2,4]triazolo[4,3-d][1,2,4]triazine.
| Compound Name | (8aR)-1-(4-nitrophenyl)-3,6,8,8a-tetraphenyl-5H-[1,2,4]triazolo[4,3-d][1,2,4]triazine |
|---|---|
| PubChem CID | 14868163 |
| Molecular Formula | C34H26N6O2 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | (8aR)-1-(4-nitrophenyl)-3,6,8,8a-tetraphenyl-5H-[1,2,4]triazolo[4,3-d][1,2,4]triazine |
| SMILES | O=[N+]([O-])c1ccc(N2N=C(c3ccccc3)N3CN(c4ccccc4)N=C(c4ccccc4)[C@]32c2ccccc2)cc1 |
| InChI | InChI=1S/C34H26N6O2/c41-40(42)31-23-21-30(22-24-31)39-34(28-17-9-3-10-18-28)32(26-13-5-1-6-14-26)35-38(29-19-11-4-12-20-29)25-37(34)33(36-39)27-15-7-2-8-16-27/h1-24H,25H2/t34-/m1/s1 |
| InChIKey | UZAXAHNCJVXPBE-UUWRZZSWSA-N |
| XLogP | 6.81 |
| TPSA | 77.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|