C26H18N6O4 — CID 14737262
2,5-bis(4-nitrophenyl)-4,6-diphenyl-1,2,3,5-tetrazine (PubChem CID 14737262) has the molecular formula C26H18N6O4 and a molecular weight of 478.47 g/mol. Its IUPAC name is 2,5-bis(4-nitrophenyl)-4,6-diphenyl-1,2,3,5-tetrazine.
| Compound Name | 2,5-bis(4-nitrophenyl)-4,6-diphenyl-1,2,3,5-tetrazine |
|---|---|
| PubChem CID | 14737262 |
| Molecular Formula | C26H18N6O4 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2,5-bis(4-nitrophenyl)-4,6-diphenyl-1,2,3,5-tetrazine |
| SMILES | O=[N+]([O-])c1ccc(N2N=C(c3ccccc3)N(c3ccc([N+](=O)[O-])cc3)C(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C26H18N6O4/c33-31(34)23-15-11-21(12-16-23)29-25(19-7-3-1-4-8-19)27-30(22-13-17-24(18-14-22)32(35)36)28-26(29)20-9-5-2-6-10-20/h1-18H |
| InChIKey | POSJYKYCKCWGNL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 117.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|