C34H24N6O2 — CID 10674177
21-(4-nitrophenyl)-16,19-diphenyl-15,16,18,20,21-pentazapentacyclo[12.7.0.01,18.02,7.08,13]henicosa-2,4,6,8,10,12,14,19-octaene (PubChem CID 10674177) has the molecular formula C34H24N6O2 and a molecular weight of 548.61 g/mol. Its IUPAC name is 21-(4-nitrophenyl)-16,19-diphenyl-15,16,18,20,21-pentazapentacyclo[12.7.0.01,18.02,7.08,13]henicosa-2,4,6,8,10,12,14,19-octaene.
| Compound Name | 21-(4-nitrophenyl)-16,19-diphenyl-15,16,18,20,21-pentazapentacyclo[12.7.0.01,18.02,7.08,13]henicosa-2,4,6,8,10,12,14,19-octaene |
|---|---|
| PubChem CID | 10674177 |
| Molecular Formula | C34H24N6O2 |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | 21-(4-nitrophenyl)-16,19-diphenyl-15,16,18,20,21-pentazapentacyclo[12.7.0.01,18.02,7.08,13]henicosa-2,4,6,8,10,12,14,19-octaene |
| SMILES | O=[N+]([O-])c1ccc(N2N=C(c3ccccc3)N3CN(c4ccccc4)N=C4c5ccccc5-c5ccccc5C432)cc1 |
| InChI | InChI=1S/C34H24N6O2/c41-40(42)27-21-19-26(20-22-27)39-34-31-18-10-9-16-29(31)28-15-7-8-17-30(28)32(34)35-38(25-13-5-2-6-14-25)23-37(34)33(36-39)24-11-3-1-4-12-24/h1-22H,23H2 |
| InChIKey | WSROAEFUPUVOHM-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 77.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|