C9H19NO4S — CID 106246276
4-(1,1-dioxo-1,4-thiazinan-4-yl)-1-methoxybutan-2-ol (PubChem CID 106246276) has the molecular formula C9H19NO4S and a molecular weight of 237.32 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1-methoxybutan-2-ol.
| Compound Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1-methoxybutan-2-ol |
|---|---|
| PubChem CID | 106246276 |
| Molecular Formula | C9H19NO4S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1-methoxybutan-2-ol |
| SMILES | COCC(O)CCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H19NO4S/c1-14-8-9(11)2-3-10-4-6-15(12,13)7-5-10/h9,11H,2-8H2,1H3 |
| InChIKey | HGCUSCSAHPGGTE-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |