C11H21NO5S — CID 58283303
3-methoxypropyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate (PubChem CID 58283303) has the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. Its IUPAC name is 3-methoxypropyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate.
| Compound Name | 3-methoxypropyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate |
|---|---|
| PubChem CID | 58283303 |
| Molecular Formula | C11H21NO5S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 3-methoxypropyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate |
| SMILES | COCCCOC(=O)CCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H21NO5S/c1-16-7-2-8-17-11(13)3-4-12-5-9-18(14,15)10-6-12/h2-10H2,1H3 |
| InChIKey | SIRFKCPXYVVSHS-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|