C12H18F5NO4S — CID 58283295
3,3,5,5,5-pentafluoropentyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate (PubChem CID 58283295) has the molecular formula C12H18F5NO4S and a molecular weight of 367.34 g/mol. Its IUPAC name is 3,3,5,5,5-pentafluoropentyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate.
| Compound Name | 3,3,5,5,5-pentafluoropentyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate |
|---|---|
| PubChem CID | 58283295 |
| Molecular Formula | C12H18F5NO4S |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 3,3,5,5,5-pentafluoropentyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate |
| SMILES | O=C(CCN1CCS(=O)(=O)CC1)OCCC(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C12H18F5NO4S/c13-11(14,9-12(15,16)17)2-6-22-10(19)1-3-18-4-7-23(20,21)8-5-18/h1-9H2 |
| InChIKey | GXNCMNDYRFTGOB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |