C17H27NO4S — CID 58283192
2-adamantyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate (PubChem CID 58283192) has the molecular formula C17H27NO4S and a molecular weight of 341.47 g/mol. Its IUPAC name is 2-adamantyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate.
| Compound Name | 2-adamantyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate |
|---|---|
| PubChem CID | 58283192 |
| Molecular Formula | C17H27NO4S |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-adamantyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate |
| SMILES | O=C(CCN1CCS(=O)(=O)CC1)OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C17H27NO4S/c19-16(1-2-18-3-5-23(20,21)6-4-18)22-17-14-8-12-7-13(10-14)11-15(17)9-12/h12-15,17H,1-11H2 |
| InChIKey | YHLRCSSNDOLDAI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |