C9H15NO4S — CID 58283249
2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl prop-2-enoate (PubChem CID 58283249) has the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl prop-2-enoate.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 58283249 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H15NO4S/c1-2-9(11)14-6-3-10-4-7-15(12,13)8-5-10/h2H,1,3-8H2 |
| InChIKey | WGQUETSGMRQUAI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|