C15H26N2O3 — CID 123270459
[4-(aziridin-1-yl)-2-[2-[2-(aziridin-1-yl)ethoxy]ethyl]butyl] prop-2-enoate (PubChem CID 123270459) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is [4-(aziridin-1-yl)-2-[2-[2-(aziridin-1-yl)ethoxy]ethyl]butyl] prop-2-enoate.
| Compound Name | [4-(aziridin-1-yl)-2-[2-[2-(aziridin-1-yl)ethoxy]ethyl]butyl] prop-2-enoate |
|---|---|
| PubChem CID | 123270459 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | [4-(aziridin-1-yl)-2-[2-[2-(aziridin-1-yl)ethoxy]ethyl]butyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(CCOCCN1CC1)CCN1CC1 |
| InChI | InChI=1S/C15H26N2O3/c1-2-15(18)20-13-14(3-5-16-6-7-16)4-11-19-12-10-17-8-9-17/h2,14H,1,3-13H2 |
| InChIKey | NNTRPDHSYYPPOE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 41.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|