C14H27N3O2 — CID 66735577
2-[3,5-di(propan-2-yl)-1,3,5-triazinan-1-yl]ethyl prop-2-enoate (PubChem CID 66735577) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-[3,5-di(propan-2-yl)-1,3,5-triazinan-1-yl]ethyl prop-2-enoate.
| Compound Name | 2-[3,5-di(propan-2-yl)-1,3,5-triazinan-1-yl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 66735577 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 2-[3,5-di(propan-2-yl)-1,3,5-triazinan-1-yl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN1CN(C(C)C)CN(C(C)C)C1 |
| InChI | InChI=1S/C14H27N3O2/c1-6-14(18)19-8-7-15-9-16(12(2)3)11-17(10-15)13(4)5/h6,12-13H,1,7-11H2,2-5H3 |
| InChIKey | WJQVHUIGXPIPSS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|